C23H21NO8 — CID 96544264
ethyl (2S,3R)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxylate (PubChem CID 96544264) has the molecular formula C23H21NO8 and a molecular weight of 439.42 g/mol. Its IUPAC name is ethyl (2S,3R)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxylate.
| Compound Name | ethyl (2S,3R)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxylate |
|---|---|
| PubChem CID | 96544264 |
| Molecular Formula | C23H21NO8 |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | ethyl (2S,3R)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1Oc2c(c(=O)oc3ccccc23)[C@H]1c1ccc(OCC(N)=O)c(OC)c1 |
| InChI | InChI=1S/C23H21NO8/c1-3-29-23(27)21-18(12-8-9-15(16(10-12)28-2)30-11-17(24)25)19-20(32-21)13-6-4-5-7-14(13)31-22(19)26/h4-10,18,21H,3,11H2,1-2H3,(H2,24,25)/t18-,21+/m1/s1 |
| InChIKey | FEQOZWRQPASHRV-NQIIRXRSSA-N |
| XLogP | 2.12 |
| TPSA | 127.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|