C12H7F3O5 — CID 167299735
4-hydroxy-6-methoxy-3-(2,2,2-trifluoroacetyl)chromen-2-one (PubChem CID 167299735) has the molecular formula C12H7F3O5 and a molecular weight of 288.18 g/mol. Its IUPAC name is 4-hydroxy-6-methoxy-3-(2,2,2-trifluoroacetyl)chromen-2-one.
| Compound Name | 4-hydroxy-6-methoxy-3-(2,2,2-trifluoroacetyl)chromen-2-one |
|---|---|
| PubChem CID | 167299735 |
| Molecular Formula | C12H7F3O5 |
| Molecular Weight | 288.18 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 4-hydroxy-6-methoxy-3-(2,2,2-trifluoroacetyl)chromen-2-one |
| SMILES | COc1ccc2oc(=O)c(C(=O)C(F)(F)F)c(O)c2c1 |
| InChI | InChI=1S/C12H7F3O5/c1-19-5-2-3-7-6(4-5)9(16)8(11(18)20-7)10(17)12(13,14)15/h2-4,16H,1H3 |
| InChIKey | WDHVHTLSISRMNA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.18 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|