C18H12F3NO4 — CID 102416335
4-(4-methoxyanilino)-3-(2,2,2-trifluoroacetyl)chromen-2-one (PubChem CID 102416335) has the molecular formula C18H12F3NO4 and a molecular weight of 363.29 g/mol. Its IUPAC name is 4-(4-methoxyanilino)-3-(2,2,2-trifluoroacetyl)chromen-2-one.
| Compound Name | 4-(4-methoxyanilino)-3-(2,2,2-trifluoroacetyl)chromen-2-one |
|---|---|
| PubChem CID | 102416335 |
| Molecular Formula | C18H12F3NO4 |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 4-(4-methoxyanilino)-3-(2,2,2-trifluoroacetyl)chromen-2-one |
| SMILES | COc1ccc(Nc2c(C(=O)C(F)(F)F)c(=O)oc3ccccc23)cc1 |
| InChI | InChI=1S/C18H12F3NO4/c1-25-11-8-6-10(7-9-11)22-15-12-4-2-3-5-13(12)26-17(24)14(15)16(23)18(19,20)21/h2-9,22H,1H3 |
| InChIKey | NJJQSGSTHLJOLY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|