C24H18N2O3 — CID 122370928
3-(4-methoxyanilino)-2-phenyl-1H-chromeno[4,3-b]pyrrol-4-one (PubChem CID 122370928) has the molecular formula C24H18N2O3 and a molecular weight of 382.42 g/mol. Its IUPAC name is 3-(4-methoxyanilino)-2-phenyl-1H-chromeno[4,3-b]pyrrol-4-one.
| Compound Name | 3-(4-methoxyanilino)-2-phenyl-1H-chromeno[4,3-b]pyrrol-4-one |
|---|---|
| PubChem CID | 122370928 |
| Molecular Formula | C24H18N2O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 3-(4-methoxyanilino)-2-phenyl-1H-chromeno[4,3-b]pyrrol-4-one |
| SMILES | COc1ccc(Nc2c(-c3ccccc3)[nH]c3c2c(=O)oc2ccccc23)cc1 |
| InChI | InChI=1S/C24H18N2O3/c1-28-17-13-11-16(12-14-17)25-23-20-22(26-21(23)15-7-3-2-4-8-15)18-9-5-6-10-19(18)29-24(20)27/h2-14,25-26H,1H3 |
| InChIKey | LZQMRZYJJHKSHA-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|