C23H23NO4 — CID 171804076
2-[3-[(4-methoxyphenyl)methoxy]propyl]-3-methyl-1H-chromeno[4,3-b]pyrrol-4-one (PubChem CID 171804076) has the molecular formula C23H23NO4 and a molecular weight of 377.44 g/mol. Its IUPAC name is 2-[3-[(4-methoxyphenyl)methoxy]propyl]-3-methyl-1H-chromeno[4,3-b]pyrrol-4-one.
| Compound Name | 2-[3-[(4-methoxyphenyl)methoxy]propyl]-3-methyl-1H-chromeno[4,3-b]pyrrol-4-one |
|---|---|
| PubChem CID | 171804076 |
| Molecular Formula | C23H23NO4 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 2-[3-[(4-methoxyphenyl)methoxy]propyl]-3-methyl-1H-chromeno[4,3-b]pyrrol-4-one |
| SMILES | COc1ccc(COCCCc2[nH]c3c(c2C)c(=O)oc2ccccc23)cc1 |
| InChI | InChI=1S/C23H23NO4/c1-15-19(7-5-13-27-14-16-9-11-17(26-2)12-10-16)24-22-18-6-3-4-8-20(18)28-23(25)21(15)22/h3-4,6,8-12,24H,5,7,13-14H2,1-2H3 |
| InChIKey | CPDPVVFKWUAOBD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 64.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|