C19H15NO3 — CID 164681987
1-(4-methoxyphenyl)-3-methylchromeno[4,3-b]pyrrol-4-one (PubChem CID 164681987) has the molecular formula C19H15NO3 and a molecular weight of 305.33 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-methylchromeno[4,3-b]pyrrol-4-one.
| Compound Name | 1-(4-methoxyphenyl)-3-methylchromeno[4,3-b]pyrrol-4-one |
|---|---|
| PubChem CID | 164681987 |
| Molecular Formula | C19H15NO3 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-methylchromeno[4,3-b]pyrrol-4-one |
| SMILES | COc1ccc(-n2cc(C)c3c(=O)oc4ccccc4c32)cc1 |
| InChI | InChI=1S/C19H15NO3/c1-12-11-20(13-7-9-14(22-2)10-8-13)18-15-5-3-4-6-16(15)23-19(21)17(12)18/h3-11H,1-2H3 |
| InChIKey | KUMLIGCPIBUCAG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 44.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|