C18H13ClN2O3 — CID 139225177
8-chloro-1-(4-methoxyphenyl)-3-methylchromeno[3,4-d]pyrazol-4-one (PubChem CID 139225177) has the molecular formula C18H13ClN2O3 and a molecular weight of 340.77 g/mol. Its IUPAC name is 8-chloro-1-(4-methoxyphenyl)-3-methylchromeno[3,4-d]pyrazol-4-one.
| Compound Name | 8-chloro-1-(4-methoxyphenyl)-3-methylchromeno[3,4-d]pyrazol-4-one |
|---|---|
| PubChem CID | 139225177 |
| Molecular Formula | C18H13ClN2O3 |
| Molecular Weight | 340.77 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 8-chloro-1-(4-methoxyphenyl)-3-methylchromeno[3,4-d]pyrazol-4-one |
| SMILES | COc1ccc(-n2nc(C)c3c(=O)oc4ccc(Cl)cc4c32)cc1 |
| InChI | InChI=1S/C18H13ClN2O3/c1-10-16-17(14-9-11(19)3-8-15(14)24-18(16)22)21(20-10)12-4-6-13(23-2)7-5-12/h3-9H,1-2H3 |
| InChIKey | XUOXKZJBEWZULO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.77 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|