C18H13ClN2O2 — CID 139225176
8-chloro-3-methyl-1-(4-methylphenyl)chromeno[3,4-d]pyrazol-4-one (PubChem CID 139225176) has the molecular formula C18H13ClN2O2 and a molecular weight of 324.77 g/mol. Its IUPAC name is 8-chloro-3-methyl-1-(4-methylphenyl)chromeno[3,4-d]pyrazol-4-one.
| Compound Name | 8-chloro-3-methyl-1-(4-methylphenyl)chromeno[3,4-d]pyrazol-4-one |
|---|---|
| PubChem CID | 139225176 |
| Molecular Formula | C18H13ClN2O2 |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 8-chloro-3-methyl-1-(4-methylphenyl)chromeno[3,4-d]pyrazol-4-one |
| SMILES | Cc1ccc(-n2nc(C)c3c(=O)oc4ccc(Cl)cc4c32)cc1 |
| InChI | InChI=1S/C18H13ClN2O2/c1-10-3-6-13(7-4-10)21-17-14-9-12(19)5-8-15(14)23-18(22)16(17)11(2)20-21/h3-9H,1-2H3 |
| InChIKey | HYQCFZYNUTVXQH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|