C18H11N3O2S — CID 46702722
1-(1,3-benzothiazol-2-yl)-3-methylchromeno[3,4-d]pyrazol-4-one (PubChem CID 46702722) has the molecular formula C18H11N3O2S and a molecular weight of 333.37 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3-methylchromeno[3,4-d]pyrazol-4-one.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-3-methylchromeno[3,4-d]pyrazol-4-one |
|---|---|
| PubChem CID | 46702722 |
| Molecular Formula | C18H11N3O2S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-3-methylchromeno[3,4-d]pyrazol-4-one |
| SMILES | Cc1nn(-c2nc3ccccc3s2)c2c1c(=O)oc1ccccc12 |
| InChI | InChI=1S/C18H11N3O2S/c1-10-15-16(11-6-2-4-8-13(11)23-17(15)22)21(20-10)18-19-12-7-3-5-9-14(12)24-18/h2-9H,1H3 |
| InChIKey | GZXMDSDCNLWYOF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|