C22H18N2O4 — CID 176516568
ethyl (E)-3-[2-(3-methyl-4-oxochromeno[3,4-d]pyrazol-1-yl)phenyl]prop-2-enoate (PubChem CID 176516568) has the molecular formula C22H18N2O4 and a molecular weight of 374.40 g/mol. Its IUPAC name is ethyl (E)-3-[2-(3-methyl-4-oxochromeno[3,4-d]pyrazol-1-yl)phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[2-(3-methyl-4-oxochromeno[3,4-d]pyrazol-1-yl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 176516568 |
| Molecular Formula | C22H18N2O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | ethyl (E)-3-[2-(3-methyl-4-oxochromeno[3,4-d]pyrazol-1-yl)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccccc1-n1nc(C)c2c(=O)oc3ccccc3c21 |
| InChI | InChI=1S/C22H18N2O4/c1-3-27-19(25)13-12-15-8-4-6-10-17(15)24-21-16-9-5-7-11-18(16)28-22(26)20(21)14(2)23-24/h4-13H,3H2,1-2H3/b13-12+ |
| InChIKey | NVLLOBJQWCUETJ-OUKQBFOZSA-N |
| XLogP | 4.02 |
| TPSA | 74.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|