C17H18O4 — CID 66560052
ethyl (E)-3-(5,6,7-trimethyl-2-oxochromen-3-yl)prop-2-enoate (PubChem CID 66560052) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is ethyl (E)-3-(5,6,7-trimethyl-2-oxochromen-3-yl)prop-2-enoate.
| Compound Name | ethyl (E)-3-(5,6,7-trimethyl-2-oxochromen-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 66560052 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | ethyl (E)-3-(5,6,7-trimethyl-2-oxochromen-3-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cc2c(C)c(C)c(C)cc2oc1=O |
| InChI | InChI=1S/C17H18O4/c1-5-20-16(18)7-6-13-9-14-12(4)11(3)10(2)8-15(14)21-17(13)19/h6-9H,5H2,1-4H3/b7-6+ |
| InChIKey | XXRSPAOQQYRQBR-VOTSOKGWSA-N |
| XLogP | 3.29 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|