C14H12ClNO4 — CID 66921761
ethyl (E)-3-(6-chloro-8-methyl-4-oxo-3,1-benzoxazin-2-yl)prop-2-enoate (PubChem CID 66921761) has the molecular formula C14H12ClNO4 and a molecular weight of 293.71 g/mol. Its IUPAC name is ethyl (E)-3-(6-chloro-8-methyl-4-oxo-3,1-benzoxazin-2-yl)prop-2-enoate.
| Compound Name | ethyl (E)-3-(6-chloro-8-methyl-4-oxo-3,1-benzoxazin-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 66921761 |
| Molecular Formula | C14H12ClNO4 |
| Molecular Weight | 293.71 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | ethyl (E)-3-(6-chloro-8-methyl-4-oxo-3,1-benzoxazin-2-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1nc2c(C)cc(Cl)cc2c(=O)o1 |
| InChI | InChI=1S/C14H12ClNO4/c1-3-19-12(17)5-4-11-16-13-8(2)6-9(15)7-10(13)14(18)20-11/h4-7H,3H2,1-2H3/b5-4+ |
| InChIKey | YPHCDYMGSYFXQB-SNAWJCMRSA-N |
| XLogP | 2.73 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.71 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|