C20H18N2O2 — CID 139225175
1-(4-methylphenyl)-3-propylchromeno[3,4-d]pyrazol-4-one (PubChem CID 139225175) has the molecular formula C20H18N2O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-propylchromeno[3,4-d]pyrazol-4-one.
| Compound Name | 1-(4-methylphenyl)-3-propylchromeno[3,4-d]pyrazol-4-one |
|---|---|
| PubChem CID | 139225175 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 1-(4-methylphenyl)-3-propylchromeno[3,4-d]pyrazol-4-one |
| SMILES | CCCc1nn(-c2ccc(C)cc2)c2c1c(=O)oc1ccccc12 |
| InChI | InChI=1S/C20H18N2O2/c1-3-6-16-18-19(15-7-4-5-8-17(15)24-20(18)23)22(21-16)14-11-9-13(2)10-12-14/h4-5,7-12H,3,6H2,1-2H3 |
| InChIKey | BEDSAPOWZUFJHT-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|