C20H13N3O2 — CID 164668894
13-methyl-15-phenyl-8-oxa-14,15,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,11,13,16-heptaen-9-one (PubChem CID 164668894) has the molecular formula C20H13N3O2 and a molecular weight of 327.34 g/mol. Its IUPAC name is 13-methyl-15-phenyl-8-oxa-14,15,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,11,13,16-heptaen-9-one.
| Compound Name | 13-methyl-15-phenyl-8-oxa-14,15,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,11,13,16-heptaen-9-one |
|---|---|
| PubChem CID | 164668894 |
| Molecular Formula | C20H13N3O2 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 13-methyl-15-phenyl-8-oxa-14,15,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,11,13,16-heptaen-9-one |
| SMILES | Cc1nn(-c2ccccc2)c2nc3c(cc12)c(=O)oc1ccccc13 |
| InChI | InChI=1S/C20H13N3O2/c1-12-15-11-16-18(14-9-5-6-10-17(14)25-20(16)24)21-19(15)23(22-12)13-7-3-2-4-8-13/h2-11H,1H3 |
| InChIKey | JMYBSHBNMQPZKF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|