C19H15N3 — CID 4671441
3-methyl-1,6-diphenylpyrazolo[5,4-b]pyridine (PubChem CID 4671441) has the molecular formula C19H15N3 and a molecular weight of 285.35 g/mol. Its IUPAC name is 3-methyl-1,6-diphenylpyrazolo[5,4-b]pyridine.
| Compound Name | 3-methyl-1,6-diphenylpyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 4671441 |
| Molecular Formula | C19H15N3 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 3-methyl-1,6-diphenylpyrazolo[5,4-b]pyridine |
| SMILES | Cc1nn(-c2ccccc2)c2nc(-c3ccccc3)ccc12 |
| InChI | InChI=1S/C19H15N3/c1-14-17-12-13-18(15-8-4-2-5-9-15)20-19(17)22(21-14)16-10-6-3-7-11-16/h2-13H,1H3 |
| InChIKey | OWKSSVUXUJDVCN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |