C18H14N2S — CID 101454475
3-methyl-1,5-diphenylthieno[3,2-d]pyrazole (PubChem CID 101454475) has the molecular formula C18H14N2S and a molecular weight of 290.39 g/mol. Its IUPAC name is 3-methyl-1,5-diphenylthieno[3,2-d]pyrazole.
| Compound Name | 3-methyl-1,5-diphenylthieno[3,2-d]pyrazole |
|---|---|
| PubChem CID | 101454475 |
| Molecular Formula | C18H14N2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 3-methyl-1,5-diphenylthieno[3,2-d]pyrazole |
| SMILES | Cc1nn(-c2ccccc2)c2sc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C18H14N2S/c1-13-16-12-17(14-8-4-2-5-9-14)21-18(16)20(19-13)15-10-6-3-7-11-15/h2-12H,1H3 |
| InChIKey | NDURSUMOSFELLT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |