C33H23N3O2 — CID 150484079
2-(3,5-dimethyl-1,4-diphenylpyrazolo[5,4-b]pyridin-6-yl)benzo[f]chromen-3-one (PubChem CID 150484079) has the molecular formula C33H23N3O2 and a molecular weight of 493.57 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1,4-diphenylpyrazolo[5,4-b]pyridin-6-yl)benzo[f]chromen-3-one.
| Compound Name | 2-(3,5-dimethyl-1,4-diphenylpyrazolo[5,4-b]pyridin-6-yl)benzo[f]chromen-3-one |
|---|---|
| PubChem CID | 150484079 |
| Molecular Formula | C33H23N3O2 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 2-(3,5-dimethyl-1,4-diphenylpyrazolo[5,4-b]pyridin-6-yl)benzo[f]chromen-3-one |
| SMILES | Cc1c(-c2cc3c(ccc4ccccc43)oc2=O)nc2c(c(C)nn2-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C33H23N3O2/c1-20-29(23-12-5-3-6-13-23)30-21(2)35-36(24-14-7-4-8-15-24)32(30)34-31(20)27-19-26-25-16-10-9-11-22(25)17-18-28(26)38-33(27)37/h3-19H,1-2H3 |
| InChIKey | HUKWWOHJNVJECY-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|