C20H16ClN3O3 — CID 21395783
3-[3-chloro-4-(4,5-dimethyltriazol-2-yl)phenyl]-7-methoxychromen-2-one (PubChem CID 21395783) has the molecular formula C20H16ClN3O3 and a molecular weight of 381.82 g/mol. Its IUPAC name is 3-[3-chloro-4-(4,5-dimethyltriazol-2-yl)phenyl]-7-methoxychromen-2-one.
| Compound Name | 3-[3-chloro-4-(4,5-dimethyltriazol-2-yl)phenyl]-7-methoxychromen-2-one |
|---|---|
| PubChem CID | 21395783 |
| Molecular Formula | C20H16ClN3O3 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 3-[3-chloro-4-(4,5-dimethyltriazol-2-yl)phenyl]-7-methoxychromen-2-one |
| SMILES | COc1ccc2cc(-c3ccc(-n4nc(C)c(C)n4)c(Cl)c3)c(=O)oc2c1 |
| InChI | InChI=1S/C20H16ClN3O3/c1-11-12(2)23-24(22-11)18-7-5-13(9-17(18)21)16-8-14-4-6-15(26-3)10-19(14)27-20(16)25/h4-10H,1-3H3 |
| InChIKey | SIOGPGFOVBRGJW-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 70.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|