C19H14N2O5 — CID 22423891
7-methoxy-3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]chromen-2-one (PubChem CID 22423891) has the molecular formula C19H14N2O5 and a molecular weight of 350.33 g/mol. Its IUPAC name is 7-methoxy-3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]chromen-2-one.
| Compound Name | 7-methoxy-3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]chromen-2-one |
|---|---|
| PubChem CID | 22423891 |
| Molecular Formula | C19H14N2O5 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 7-methoxy-3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]chromen-2-one |
| SMILES | COc1ccc(-c2noc(-c3cc4ccc(OC)cc4oc3=O)n2)cc1 |
| InChI | InChI=1S/C19H14N2O5/c1-23-13-6-3-11(4-7-13)17-20-18(26-21-17)15-9-12-5-8-14(24-2)10-16(12)25-19(15)22/h3-10H,1-2H3 |
| InChIKey | RBBBKIXKJQQETH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 87.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|