C18H12N2O4 — CID 851433
3-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]chromen-2-one (PubChem CID 851433) has the molecular formula C18H12N2O4 and a molecular weight of 320.30 g/mol. Its IUPAC name is 3-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]chromen-2-one.
| Compound Name | 3-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]chromen-2-one |
|---|---|
| PubChem CID | 851433 |
| Molecular Formula | C18H12N2O4 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 3-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]chromen-2-one |
| SMILES | COc1cccc(-c2noc(-c3cc4ccccc4oc3=O)n2)c1 |
| InChI | InChI=1S/C18H12N2O4/c1-22-13-7-4-6-12(9-13)16-19-17(24-20-16)14-10-11-5-2-3-8-15(11)23-18(14)21/h2-10H,1H3 |
| InChIKey | IXQVZFBJFFNKRT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 78.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|