C19H13BrN2O5 — CID 20904266
6-bromo-3-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]chromen-2-one (PubChem CID 20904266) has the molecular formula C19H13BrN2O5 and a molecular weight of 429.23 g/mol. Its IUPAC name is 6-bromo-3-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]chromen-2-one.
| Compound Name | 6-bromo-3-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]chromen-2-one |
|---|---|
| PubChem CID | 20904266 |
| Molecular Formula | C19H13BrN2O5 |
| Molecular Weight | 429.23 g/mol |
| Exact Mass | 428.00 |
| IUPAC Name | 6-bromo-3-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]chromen-2-one |
| SMILES | COc1ccc(-c2noc(-c3cc4cc(Br)ccc4oc3=O)n2)cc1OC |
| InChI | InChI=1S/C19H13BrN2O5/c1-24-15-5-3-10(9-16(15)25-2)17-21-18(27-22-17)13-8-11-7-12(20)4-6-14(11)26-19(13)23/h3-9H,1-2H3 |
| InChIKey | ITXIZSYYROCHLR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 87.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.23 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|