C17H14BrNO4 — CID 12710979
2-amino-6-bromo-3-(3,4-dimethoxyphenyl)chromen-4-one (PubChem CID 12710979) has the molecular formula C17H14BrNO4 and a molecular weight of 376.21 g/mol. Its IUPAC name is 2-amino-6-bromo-3-(3,4-dimethoxyphenyl)chromen-4-one.
| Compound Name | 2-amino-6-bromo-3-(3,4-dimethoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 12710979 |
| Molecular Formula | C17H14BrNO4 |
| Molecular Weight | 376.21 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | 2-amino-6-bromo-3-(3,4-dimethoxyphenyl)chromen-4-one |
| SMILES | COc1ccc(-c2c(N)oc3ccc(Br)cc3c2=O)cc1OC |
| InChI | InChI=1S/C17H14BrNO4/c1-21-13-5-3-9(7-14(13)22-2)15-16(20)11-8-10(18)4-6-12(11)23-17(15)19/h3-8H,19H2,1-2H3 |
| InChIKey | NMOGVKNIEASKRC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.21 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |