C24H17ClFNO5 — CID 4898865
N-[6-chloro-3-(3,4-dimethoxyphenyl)-4-oxochromen-2-yl]-4-fluorobenzamide (PubChem CID 4898865) has the molecular formula C24H17ClFNO5 and a molecular weight of 453.85 g/mol. Its IUPAC name is N-[6-chloro-3-(3,4-dimethoxyphenyl)-4-oxochromen-2-yl]-4-fluorobenzamide.
| Compound Name | N-[6-chloro-3-(3,4-dimethoxyphenyl)-4-oxochromen-2-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 4898865 |
| Molecular Formula | C24H17ClFNO5 |
| Molecular Weight | 453.85 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | N-[6-chloro-3-(3,4-dimethoxyphenyl)-4-oxochromen-2-yl]-4-fluorobenzamide |
| SMILES | COc1ccc(-c2c(NC(=O)c3ccc(F)cc3)oc3ccc(Cl)cc3c2=O)cc1OC |
| InChI | InChI=1S/C24H17ClFNO5/c1-30-19-9-5-14(11-20(19)31-2)21-22(28)17-12-15(25)6-10-18(17)32-24(21)27-23(29)13-3-7-16(26)8-4-13/h3-12H,1-2H3,(H,27,29) |
| InChIKey | KAZYPBQTXDPFTB-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.85 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |