C21H14ClNO4 — CID 4895274
N-[6-chloro-3-(4-methylphenyl)-4-oxochromen-2-yl]furan-2-carboxamide (PubChem CID 4895274) has the molecular formula C21H14ClNO4 and a molecular weight of 379.80 g/mol. Its IUPAC name is N-[6-chloro-3-(4-methylphenyl)-4-oxochromen-2-yl]furan-2-carboxamide.
| Compound Name | N-[6-chloro-3-(4-methylphenyl)-4-oxochromen-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 4895274 |
| Molecular Formula | C21H14ClNO4 |
| Molecular Weight | 379.80 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | N-[6-chloro-3-(4-methylphenyl)-4-oxochromen-2-yl]furan-2-carboxamide |
| SMILES | Cc1ccc(-c2c(NC(=O)c3ccco3)oc3ccc(Cl)cc3c2=O)cc1 |
| InChI | InChI=1S/C21H14ClNO4/c1-12-4-6-13(7-5-12)18-19(24)15-11-14(22)8-9-16(15)27-21(18)23-20(25)17-3-2-10-26-17/h2-11H,1H3,(H,23,25) |
| InChIKey | YHASUGDGWOUXJB-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 72.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.80 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |