C11H6Br2ClNO2 — CID 4192583
N-(2,6-dibromo-4-chlorophenyl)furan-2-carboxamide (PubChem CID 4192583) has the molecular formula C11H6Br2ClNO2 and a molecular weight of 379.44 g/mol. Its IUPAC name is N-(2,6-dibromo-4-chlorophenyl)furan-2-carboxamide.
| Compound Name | N-(2,6-dibromo-4-chlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 4192583 |
| Molecular Formula | C11H6Br2ClNO2 |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 376.85 |
| IUPAC Name | N-(2,6-dibromo-4-chlorophenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1c(Br)cc(Cl)cc1Br)c1ccco1 |
| InChI | InChI=1S/C11H6Br2ClNO2/c12-7-4-6(14)5-8(13)10(7)15-11(16)9-2-1-3-17-9/h1-5H,(H,15,16) |
| InChIKey | JQADFACCYBWZCO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |