C23H13ClFNO5 — CID 4896449
N-[3-(1,3-benzodioxol-5-yl)-6-chloro-4-oxochromen-2-yl]-4-fluorobenzamide (PubChem CID 4896449) has the molecular formula C23H13ClFNO5 and a molecular weight of 437.81 g/mol. Its IUPAC name is N-[3-(1,3-benzodioxol-5-yl)-6-chloro-4-oxochromen-2-yl]-4-fluorobenzamide.
| Compound Name | N-[3-(1,3-benzodioxol-5-yl)-6-chloro-4-oxochromen-2-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 4896449 |
| Molecular Formula | C23H13ClFNO5 |
| Molecular Weight | 437.81 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | N-[3-(1,3-benzodioxol-5-yl)-6-chloro-4-oxochromen-2-yl]-4-fluorobenzamide |
| SMILES | O=C(Nc1oc2ccc(Cl)cc2c(=O)c1-c1ccc2c(c1)OCO2)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H13ClFNO5/c24-14-4-8-17-16(10-14)21(27)20(13-3-7-18-19(9-13)30-11-29-18)23(31-17)26-22(28)12-1-5-15(25)6-2-12/h1-10H,11H2,(H,26,28) |
| InChIKey | SILZAXBOPIHALB-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.81 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |