C27H23NO5 — CID 4909608
N-[3-(1,3-benzodioxol-5-yl)-4-oxochromen-2-yl]-4-tert-butylbenzamide (PubChem CID 4909608) has the molecular formula C27H23NO5 and a molecular weight of 441.48 g/mol. Its IUPAC name is N-[3-(1,3-benzodioxol-5-yl)-4-oxochromen-2-yl]-4-tert-butylbenzamide.
| Compound Name | N-[3-(1,3-benzodioxol-5-yl)-4-oxochromen-2-yl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 4909608 |
| Molecular Formula | C27H23NO5 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | N-[3-(1,3-benzodioxol-5-yl)-4-oxochromen-2-yl]-4-tert-butylbenzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2oc3ccccc3c(=O)c2-c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C27H23NO5/c1-27(2,3)18-11-8-16(9-12-18)25(30)28-26-23(17-10-13-21-22(14-17)32-15-31-21)24(29)19-6-4-5-7-20(19)33-26/h4-14H,15H2,1-3H3,(H,28,30) |
| InChIKey | NMQFFFWXMMWFPO-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |