C16H11NO4 — CID 86100284
3-amino-2-(1,3-benzodioxol-5-yl)chromen-4-one (PubChem CID 86100284) has the molecular formula C16H11NO4 and a molecular weight of 281.27 g/mol. Its IUPAC name is 3-amino-2-(1,3-benzodioxol-5-yl)chromen-4-one.
| Compound Name | 3-amino-2-(1,3-benzodioxol-5-yl)chromen-4-one |
|---|---|
| PubChem CID | 86100284 |
| Molecular Formula | C16H11NO4 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 3-amino-2-(1,3-benzodioxol-5-yl)chromen-4-one |
| SMILES | Nc1c(-c2ccc3c(c2)OCO3)oc2ccccc2c1=O |
| InChI | InChI=1S/C16H11NO4/c17-14-15(18)10-3-1-2-4-11(10)21-16(14)9-5-6-12-13(7-9)20-8-19-12/h1-7H,8,17H2 |
| InChIKey | IRQQZIDACLQWDY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |