C27H14O8 — CID 127252711
2-(1,3-benzodioxol-5-yl)-3-(4-hydroxy-2-oxochromen-3-yl)furo[3,2-c]chromen-4-one (PubChem CID 127252711) has the molecular formula C27H14O8 and a molecular weight of 466.40 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-3-(4-hydroxy-2-oxochromen-3-yl)furo[3,2-c]chromen-4-one.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-3-(4-hydroxy-2-oxochromen-3-yl)furo[3,2-c]chromen-4-one |
|---|---|
| PubChem CID | 127252711 |
| Molecular Formula | C27H14O8 |
| Molecular Weight | 466.40 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-3-(4-hydroxy-2-oxochromen-3-yl)furo[3,2-c]chromen-4-one |
| SMILES | O=c1oc2ccccc2c(O)c1-c1c(-c2ccc3c(c2)OCO3)oc2c1c(=O)oc1ccccc12 |
| InChI | InChI=1S/C27H14O8/c28-23-14-5-1-3-7-16(14)33-26(29)21(23)20-22-25(15-6-2-4-8-17(15)34-27(22)30)35-24(20)13-9-10-18-19(11-13)32-12-31-18/h1-11,28H,12H2 |
| InChIKey | LDDFXPTXAOONHA-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.40 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|