C21H14O7 — CID 125427913
2-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxofuro[3,2-c]chromen-3-yl]acetic acid (PubChem CID 125427913) has the molecular formula C21H14O7 and a molecular weight of 378.34 g/mol. Its IUPAC name is 2-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxofuro[3,2-c]chromen-3-yl]acetic acid.
| Compound Name | 2-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxofuro[3,2-c]chromen-3-yl]acetic acid |
|---|---|
| PubChem CID | 125427913 |
| Molecular Formula | C21H14O7 |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 2-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxofuro[3,2-c]chromen-3-yl]acetic acid |
| SMILES | O=C(O)Cc1c(-c2ccc3c(c2)OCCO3)oc2c1c(=O)oc1ccccc12 |
| InChI | InChI=1S/C21H14O7/c22-17(23)10-13-18-20(12-3-1-2-4-14(12)27-21(18)24)28-19(13)11-5-6-15-16(9-11)26-8-7-25-15/h1-6,9H,7-8,10H2,(H,22,23) |
| InChIKey | NFCQICWYUWHRDU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 99.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|