C21H14O8 — CID 125428588
2-[2-(4-hydroxy-3-methoxycarbonylphenyl)-4-oxofuro[3,2-c]chromen-3-yl]acetic acid (PubChem CID 125428588) has the molecular formula C21H14O8 and a molecular weight of 394.34 g/mol. Its IUPAC name is 2-[2-(4-hydroxy-3-methoxycarbonylphenyl)-4-oxofuro[3,2-c]chromen-3-yl]acetic acid.
| Compound Name | 2-[2-(4-hydroxy-3-methoxycarbonylphenyl)-4-oxofuro[3,2-c]chromen-3-yl]acetic acid |
|---|---|
| PubChem CID | 125428588 |
| Molecular Formula | C21H14O8 |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 2-[2-(4-hydroxy-3-methoxycarbonylphenyl)-4-oxofuro[3,2-c]chromen-3-yl]acetic acid |
| SMILES | COC(=O)c1cc(-c2oc3c(c2CC(=O)O)c(=O)oc2ccccc23)ccc1O |
| InChI | InChI=1S/C21H14O8/c1-27-20(25)12-8-10(6-7-14(12)22)18-13(9-16(23)24)17-19(29-18)11-4-2-3-5-15(11)28-21(17)26/h2-8,22H,9H2,1H3,(H,23,24) |
| InChIKey | PURFCKMWGMBCNJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 127.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|