C30H32N2O5 — CID 171038274
N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2-[2-(4-methoxyphenyl)-4-oxofuro[3,2-c]chromen-3-yl]acetamide (PubChem CID 171038274) has the molecular formula C30H32N2O5 and a molecular weight of 500.60 g/mol. Its IUPAC name is N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2-[2-(4-methoxyphenyl)-4-oxofuro[3,2-c]chromen-3-yl]acetamide.
| Compound Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2-[2-(4-methoxyphenyl)-4-oxofuro[3,2-c]chromen-3-yl]acetamide |
|---|---|
| PubChem CID | 171038274 |
| Molecular Formula | C30H32N2O5 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2-[2-(4-methoxyphenyl)-4-oxofuro[3,2-c]chromen-3-yl]acetamide |
| SMILES | COc1ccc(-c2oc3c(c2CC(=O)NC[C@@H]2CCCN4CCCC[C@H]24)c(=O)oc2ccccc23)cc1 |
| InChI | InChI=1S/C30H32N2O5/c1-35-21-13-11-19(12-14-21)28-23(27-29(37-28)22-8-2-3-10-25(22)36-30(27)34)17-26(33)31-18-20-7-6-16-32-15-5-4-9-24(20)32/h2-3,8,10-14,20,24H,4-7,9,15-18H2,1H3,(H,31,33)/t20-,24+/m0/s1 |
| InChIKey | NEHFNJDARFMOGJ-GBXCKJPGSA-N |
| XLogP | 5.14 |
| TPSA | 84.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|