C28H32N2O5 — CID 155486634
N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2-[6-(4-methoxyphenyl)furo[2,3-f][1,3]benzodioxol-7-yl]acetamide (PubChem CID 155486634) has the molecular formula C28H32N2O5 and a molecular weight of 476.57 g/mol. Its IUPAC name is N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2-[6-(4-methoxyphenyl)furo[2,3-f][1,3]benzodioxol-7-yl]acetamide.
| Compound Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2-[6-(4-methoxyphenyl)furo[2,3-f][1,3]benzodioxol-7-yl]acetamide |
|---|---|
| PubChem CID | 155486634 |
| Molecular Formula | C28H32N2O5 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2-[6-(4-methoxyphenyl)furo[2,3-f][1,3]benzodioxol-7-yl]acetamide |
| SMILES | COc1ccc(-c2oc3cc4c(cc3c2CC(=O)NC[C@@H]2CCCN3CCCC[C@H]23)OCO4)cc1 |
| InChI | InChI=1S/C28H32N2O5/c1-32-20-9-7-18(8-10-20)28-22(21-13-25-26(34-17-33-25)15-24(21)35-28)14-27(31)29-16-19-5-4-12-30-11-3-2-6-23(19)30/h7-10,13,15,19,23H,2-6,11-12,14,16-17H2,1H3,(H,29,31)/t19-,23+/m0/s1 |
| InChIKey | AJESNTDVCIZFLZ-WMZHIEFXSA-N |
| XLogP | 4.76 |
| TPSA | 73.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |