C21H29N3O2 — CID 125387938
N-[[(1S,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-5-methoxy-3-methyl-1H-indole-2-carboxamide (PubChem CID 125387938) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is N-[[(1S,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-5-methoxy-3-methyl-1H-indole-2-carboxamide.
| Compound Name | N-[[(1S,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-5-methoxy-3-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 125387938 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | N-[[(1S,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-5-methoxy-3-methyl-1H-indole-2-carboxamide |
| SMILES | COc1ccc2[nH]c(C(=O)NC[C@@H]3CCCN4CCCC[C@@H]34)c(C)c2c1 |
| InChI | InChI=1S/C21H29N3O2/c1-14-17-12-16(26-2)8-9-18(17)23-20(14)21(25)22-13-15-6-5-11-24-10-4-3-7-19(15)24/h8-9,12,15,19,23H,3-7,10-11,13H2,1-2H3,(H,22,25)/t15-,19-/m0/s1 |
| InChIKey | LBKKOBZEZMOUDN-KXBFYZLASA-N |
| XLogP | 3.48 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|