C17H22N2O3 — CID 74238881
(5-methoxy-3-methyl-1H-indol-2-yl)-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]methanone (PubChem CID 74238881) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is (5-methoxy-3-methyl-1H-indol-2-yl)-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (5-methoxy-3-methyl-1H-indol-2-yl)-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 74238881 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | (5-methoxy-3-methyl-1H-indol-2-yl)-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]methanone |
| SMILES | COC[C@H]1CCCN1C(=O)c1[nH]c2ccc(OC)cc2c1C |
| InChI | InChI=1S/C17H22N2O3/c1-11-14-9-13(22-3)6-7-15(14)18-16(11)17(20)19-8-4-5-12(19)10-21-2/h6-7,9,12,18H,4-5,8,10H2,1-3H3/t12-/m1/s1 |
| InChIKey | IBUKWVXHVWSVLD-GFCCVEGCSA-N |
| XLogP | 2.74 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|