C21H29N3O2 — CID 97123700
(3,5-dimethyl-1H-indol-2-yl)-[(2R)-2-(morpholin-4-ylmethyl)piperidin-1-yl]methanone (PubChem CID 97123700) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is (3,5-dimethyl-1H-indol-2-yl)-[(2R)-2-(morpholin-4-ylmethyl)piperidin-1-yl]methanone.
| Compound Name | (3,5-dimethyl-1H-indol-2-yl)-[(2R)-2-(morpholin-4-ylmethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 97123700 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | (3,5-dimethyl-1H-indol-2-yl)-[(2R)-2-(morpholin-4-ylmethyl)piperidin-1-yl]methanone |
| SMILES | Cc1ccc2[nH]c(C(=O)N3CCCC[C@@H]3CN3CCOCC3)c(C)c2c1 |
| InChI | InChI=1S/C21H29N3O2/c1-15-6-7-19-18(13-15)16(2)20(22-19)21(25)24-8-4-3-5-17(24)14-23-9-11-26-12-10-23/h6-7,13,17,22H,3-5,8-12,14H2,1-2H3/t17-/m1/s1 |
| InChIKey | YRXCFFUCHGQRQN-QGZVFWFLSA-N |
| XLogP | 3.11 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|