C22H31N3O — CID 92560101
2-(2,5-dimethyl-1H-indol-3-yl)-1-[(2S)-2-(pyrrolidin-1-ylmethyl)piperidin-1-yl]ethanone (PubChem CID 92560101) has the molecular formula C22H31N3O and a molecular weight of 353.51 g/mol. Its IUPAC name is 2-(2,5-dimethyl-1H-indol-3-yl)-1-[(2S)-2-(pyrrolidin-1-ylmethyl)piperidin-1-yl]ethanone.
| Compound Name | 2-(2,5-dimethyl-1H-indol-3-yl)-1-[(2S)-2-(pyrrolidin-1-ylmethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 92560101 |
| Molecular Formula | C22H31N3O |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | 2-(2,5-dimethyl-1H-indol-3-yl)-1-[(2S)-2-(pyrrolidin-1-ylmethyl)piperidin-1-yl]ethanone |
| SMILES | Cc1ccc2[nH]c(C)c(CC(=O)N3CCCC[C@H]3CN3CCCC3)c2c1 |
| InChI | InChI=1S/C22H31N3O/c1-16-8-9-21-20(13-16)19(17(2)23-21)14-22(26)25-12-4-3-7-18(25)15-24-10-5-6-11-24/h8-9,13,18,23H,3-7,10-12,14-15H2,1-2H3/t18-/m0/s1 |
| InChIKey | LMVQEDAHOTWMLQ-SFHVURJKSA-N |
| XLogP | 3.80 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|