C21H27N3O3 — CID 51935933
2-(2,5-dimethyl-1H-indol-3-yl)-1-[4-[(2S)-oxolane-2-carbonyl]piperazin-1-yl]ethanone (PubChem CID 51935933) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is 2-(2,5-dimethyl-1H-indol-3-yl)-1-[4-[(2S)-oxolane-2-carbonyl]piperazin-1-yl]ethanone.
| Compound Name | 2-(2,5-dimethyl-1H-indol-3-yl)-1-[4-[(2S)-oxolane-2-carbonyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 51935933 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 2-(2,5-dimethyl-1H-indol-3-yl)-1-[4-[(2S)-oxolane-2-carbonyl]piperazin-1-yl]ethanone |
| SMILES | Cc1ccc2[nH]c(C)c(CC(=O)N3CCN(C(=O)[C@@H]4CCCO4)CC3)c2c1 |
| InChI | InChI=1S/C21H27N3O3/c1-14-5-6-18-17(12-14)16(15(2)22-18)13-20(25)23-7-9-24(10-8-23)21(26)19-4-3-11-27-19/h5-6,12,19,22H,3-4,7-11,13H2,1-2H3/t19-/m0/s1 |
| InChIKey | MKPLWFJKNJGCNH-IBGZPJMESA-N |
| XLogP | 2.18 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|