C20H26N4O3 — CID 3887038
N'-[2-(2,5-dimethyl-1H-indol-3-yl)acetyl]-4-oxo-4-pyrrolidin-1-ylbutanehydrazide (PubChem CID 3887038) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is N'-[2-(2,5-dimethyl-1H-indol-3-yl)acetyl]-4-oxo-4-pyrrolidin-1-ylbutanehydrazide.
| Compound Name | N'-[2-(2,5-dimethyl-1H-indol-3-yl)acetyl]-4-oxo-4-pyrrolidin-1-ylbutanehydrazide |
|---|---|
| PubChem CID | 3887038 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | N'-[2-(2,5-dimethyl-1H-indol-3-yl)acetyl]-4-oxo-4-pyrrolidin-1-ylbutanehydrazide |
| SMILES | Cc1ccc2[nH]c(C)c(CC(=O)NNC(=O)CCC(=O)N3CCCC3)c2c1 |
| InChI | InChI=1S/C20H26N4O3/c1-13-5-6-17-16(11-13)15(14(2)21-17)12-19(26)23-22-18(25)7-8-20(27)24-9-3-4-10-24/h5-6,11,21H,3-4,7-10,12H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | HNISHKAJJSGPHC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|