C20H29N3O — CID 51505044
2-(2,5-dimethyl-1H-indol-3-yl)-N-[(2R)-1-pyrrolidin-1-ylbutan-2-yl]acetamide (PubChem CID 51505044) has the molecular formula C20H29N3O and a molecular weight of 327.47 g/mol. Its IUPAC name is 2-(2,5-dimethyl-1H-indol-3-yl)-N-[(2R)-1-pyrrolidin-1-ylbutan-2-yl]acetamide.
| Compound Name | 2-(2,5-dimethyl-1H-indol-3-yl)-N-[(2R)-1-pyrrolidin-1-ylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 51505044 |
| Molecular Formula | C20H29N3O |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | 2-(2,5-dimethyl-1H-indol-3-yl)-N-[(2R)-1-pyrrolidin-1-ylbutan-2-yl]acetamide |
| SMILES | CC[C@H](CN1CCCC1)NC(=O)Cc1c(C)[nH]c2ccc(C)cc12 |
| InChI | InChI=1S/C20H29N3O/c1-4-16(13-23-9-5-6-10-23)22-20(24)12-17-15(3)21-19-8-7-14(2)11-18(17)19/h7-8,11,16,21H,4-6,9-10,12-13H2,1-3H3,(H,22,24)/t16-/m1/s1 |
| InChIKey | KKZLQGJVMRLIPY-MRXNPFEDSA-N |
| XLogP | 3.32 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|