C27H39N3O8 — CID 118747336
2-hydroxypropane-1,2,3-tricarboxylic acid;N-(1-pyrrolidin-1-ylbutan-2-yl)-2-(2,5,7-trimethyl-1H-indol-3-yl)acetamide (PubChem CID 118747336) has the molecular formula C27H39N3O8 and a molecular weight of 533.62 g/mol. Its IUPAC name is 2-hydroxypropane-1,2,3-tricarboxylic acid;N-(1-pyrrolidin-1-ylbutan-2-yl)-2-(2,5,7-trimethyl-1H-indol-3-yl)acetamide.
| Compound Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;N-(1-pyrrolidin-1-ylbutan-2-yl)-2-(2,5,7-trimethyl-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 118747336 |
| Molecular Formula | C27H39N3O8 |
| Molecular Weight | 533.62 g/mol |
| Exact Mass | 533.27 |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;N-(1-pyrrolidin-1-ylbutan-2-yl)-2-(2,5,7-trimethyl-1H-indol-3-yl)acetamide |
| SMILES | CCC(CN1CCCC1)NC(=O)Cc1c(C)[nH]c2c(C)cc(C)cc12.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C21H31N3O.C6H8O7/c1-5-17(13-24-8-6-7-9-24)23-20(25)12-18-16(4)22-21-15(3)10-14(2)11-19(18)21;7-3(8)1-6(13,5(11)12)2-4(9)10/h10-11,17,22H,5-9,12-13H2,1-4H3,(H,23,25);13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | RTBWJRVKYBYWIL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 180.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.62 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|