C21H31N3O — CID 92586025
2-(2,7-dimethyl-1H-indol-3-yl)-N-[(2R)-1-piperidin-1-ylbutan-2-yl]acetamide (PubChem CID 92586025) has the molecular formula C21H31N3O and a molecular weight of 341.50 g/mol. Its IUPAC name is 2-(2,7-dimethyl-1H-indol-3-yl)-N-[(2R)-1-piperidin-1-ylbutan-2-yl]acetamide.
| Compound Name | 2-(2,7-dimethyl-1H-indol-3-yl)-N-[(2R)-1-piperidin-1-ylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 92586025 |
| Molecular Formula | C21H31N3O |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.25 |
| IUPAC Name | 2-(2,7-dimethyl-1H-indol-3-yl)-N-[(2R)-1-piperidin-1-ylbutan-2-yl]acetamide |
| SMILES | CC[C@H](CN1CCCCC1)NC(=O)Cc1c(C)[nH]c2c(C)cccc12 |
| InChI | InChI=1S/C21H31N3O/c1-4-17(14-24-11-6-5-7-12-24)23-20(25)13-19-16(3)22-21-15(2)9-8-10-18(19)21/h8-10,17,22H,4-7,11-14H2,1-3H3,(H,23,25)/t17-/m1/s1 |
| InChIKey | XILNLXDRTFITQY-QGZVFWFLSA-N |
| XLogP | 3.71 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|