C24H26N4O — CID 70739178
N-(2-imidazol-1-yl-1-phenylethyl)-2-(2,5,7-trimethyl-1H-indol-3-yl)acetamide (PubChem CID 70739178) has the molecular formula C24H26N4O and a molecular weight of 386.50 g/mol. Its IUPAC name is N-(2-imidazol-1-yl-1-phenylethyl)-2-(2,5,7-trimethyl-1H-indol-3-yl)acetamide.
| Compound Name | N-(2-imidazol-1-yl-1-phenylethyl)-2-(2,5,7-trimethyl-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 70739178 |
| Molecular Formula | C24H26N4O |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | N-(2-imidazol-1-yl-1-phenylethyl)-2-(2,5,7-trimethyl-1H-indol-3-yl)acetamide |
| SMILES | Cc1cc(C)c2[nH]c(C)c(CC(=O)NC(Cn3ccnc3)c3ccccc3)c2c1 |
| InChI | InChI=1S/C24H26N4O/c1-16-11-17(2)24-21(12-16)20(18(3)26-24)13-23(29)27-22(14-28-10-9-25-15-28)19-7-5-4-6-8-19/h4-12,15,22,26H,13-14H2,1-3H3,(H,27,29) |
| InChIKey | AKVAYEXQQBJOOD-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|