C20H19F3N4O3S — CID 166391991
N-(2-imidazol-1-yl-1-phenylethyl)-3-methyl-4-(trifluoromethylsulfonylamino)benzamide (PubChem CID 166391991) has the molecular formula C20H19F3N4O3S and a molecular weight of 452.46 g/mol. Its IUPAC name is N-(2-imidazol-1-yl-1-phenylethyl)-3-methyl-4-(trifluoromethylsulfonylamino)benzamide.
| Compound Name | N-(2-imidazol-1-yl-1-phenylethyl)-3-methyl-4-(trifluoromethylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 166391991 |
| Molecular Formula | C20H19F3N4O3S |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | N-(2-imidazol-1-yl-1-phenylethyl)-3-methyl-4-(trifluoromethylsulfonylamino)benzamide |
| SMILES | Cc1cc(C(=O)NC(Cn2ccnc2)c2ccccc2)ccc1NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C20H19F3N4O3S/c1-14-11-16(7-8-17(14)26-31(29,30)20(21,22)23)19(28)25-18(12-27-10-9-24-13-27)15-5-3-2-4-6-15/h2-11,13,18,26H,12H2,1H3,(H,25,28) |
| InChIKey | WTZWSKOSTBVOHH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |