C28H33N3O — CID 161441611
ethane;N-(2-imidazol-1-yl-1-phenylethyl)-4-phenylbenzamide (PubChem CID 161441611) has the molecular formula C28H33N3O and a molecular weight of 427.59 g/mol. Its IUPAC name is ethane;N-(2-imidazol-1-yl-1-phenylethyl)-4-phenylbenzamide.
| Compound Name | ethane;N-(2-imidazol-1-yl-1-phenylethyl)-4-phenylbenzamide |
|---|---|
| PubChem CID | 161441611 |
| Molecular Formula | C28H33N3O |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | ethane;N-(2-imidazol-1-yl-1-phenylethyl)-4-phenylbenzamide |
| SMILES | CC.CC.O=C(NC(Cn1ccnc1)c1ccccc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H21N3O.2C2H6/c28-24(22-13-11-20(12-14-22)19-7-3-1-4-8-19)26-23(17-27-16-15-25-18-27)21-9-5-2-6-10-21;2*1-2/h1-16,18,23H,17H2,(H,26,28);2*1-2H3 |
| InChIKey | VZIPWXDDVGMFRD-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |