C16H21FN2O2 — CID 109478715
2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-(1-hydroxypentan-3-yl)acetamide (PubChem CID 109478715) has the molecular formula C16H21FN2O2 and a molecular weight of 292.35 g/mol. Its IUPAC name is 2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-(1-hydroxypentan-3-yl)acetamide.
| Compound Name | 2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-(1-hydroxypentan-3-yl)acetamide |
|---|---|
| PubChem CID | 109478715 |
| Molecular Formula | C16H21FN2O2 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-(1-hydroxypentan-3-yl)acetamide |
| SMILES | CCC(CCO)NC(=O)Cc1c(C)[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C16H21FN2O2/c1-3-12(6-7-20)19-16(21)9-13-10(2)18-15-5-4-11(17)8-14(13)15/h4-5,8,12,18,20H,3,6-7,9H2,1-2H3,(H,19,21) |
| InChIKey | GEWOUXFZWUCRCJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|