C27H28N2O2 — CID 46464817
2-(2,5-dimethyl-1H-indol-3-yl)-N-[[4-(phenylmethoxymethyl)phenyl]methyl]acetamide (PubChem CID 46464817) has the molecular formula C27H28N2O2 and a molecular weight of 412.53 g/mol. Its IUPAC name is 2-(2,5-dimethyl-1H-indol-3-yl)-N-[[4-(phenylmethoxymethyl)phenyl]methyl]acetamide.
| Compound Name | 2-(2,5-dimethyl-1H-indol-3-yl)-N-[[4-(phenylmethoxymethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 46464817 |
| Molecular Formula | C27H28N2O2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 2-(2,5-dimethyl-1H-indol-3-yl)-N-[[4-(phenylmethoxymethyl)phenyl]methyl]acetamide |
| SMILES | Cc1ccc2[nH]c(C)c(CC(=O)NCc3ccc(COCc4ccccc4)cc3)c2c1 |
| InChI | InChI=1S/C27H28N2O2/c1-19-8-13-26-25(14-19)24(20(2)29-26)15-27(30)28-16-21-9-11-23(12-10-21)18-31-17-22-6-4-3-5-7-22/h3-14,29H,15-18H2,1-2H3,(H,28,30) |
| InChIKey | GFCMHTNZZILYAR-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|