C20H19N3O — CID 46591179
N-[(4-cyanophenyl)methyl]-2-(2,5-dimethyl-1H-indol-3-yl)acetamide (PubChem CID 46591179) has the molecular formula C20H19N3O and a molecular weight of 317.39 g/mol. Its IUPAC name is N-[(4-cyanophenyl)methyl]-2-(2,5-dimethyl-1H-indol-3-yl)acetamide.
| Compound Name | N-[(4-cyanophenyl)methyl]-2-(2,5-dimethyl-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 46591179 |
| Molecular Formula | C20H19N3O |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | N-[(4-cyanophenyl)methyl]-2-(2,5-dimethyl-1H-indol-3-yl)acetamide |
| SMILES | Cc1ccc2[nH]c(C)c(CC(=O)NCc3ccc(C#N)cc3)c2c1 |
| InChI | InChI=1S/C20H19N3O/c1-13-3-8-19-18(9-13)17(14(2)23-19)10-20(24)22-12-16-6-4-15(11-21)5-7-16/h3-9,23H,10,12H2,1-2H3,(H,22,24) |
| InChIKey | TXAXDGBAVCGDSE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|