C23H26N4O2 — CID 46443208
2-(2,5-dimethyl-1H-indol-3-yl)-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]acetamide (PubChem CID 46443208) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 2-(2,5-dimethyl-1H-indol-3-yl)-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]acetamide.
| Compound Name | 2-(2,5-dimethyl-1H-indol-3-yl)-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 46443208 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 2-(2,5-dimethyl-1H-indol-3-yl)-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]acetamide |
| SMILES | Cc1ccc2[nH]c(C)c(CC(=O)NCc3ccc(N4CCNC(=O)C4)cc3)c2c1 |
| InChI | InChI=1S/C23H26N4O2/c1-15-3-8-21-20(11-15)19(16(2)26-21)12-22(28)25-13-17-4-6-18(7-5-17)27-10-9-24-23(29)14-27/h3-8,11,26H,9-10,12-14H2,1-2H3,(H,24,29)(H,25,28) |
| InChIKey | UKJJLDZNZIXRQR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|