C20H20N4O2S2 — CID 55664078
N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetamide (PubChem CID 55664078) has the molecular formula C20H20N4O2S2 and a molecular weight of 412.54 g/mol. Its IUPAC name is N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 55664078 |
| Molecular Formula | C20H20N4O2S2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetamide |
| SMILES | O=C(Cc1csc(-c2ccsc2)n1)NCc1ccc(N2CCNC(=O)C2)cc1 |
| InChI | InChI=1S/C20H20N4O2S2/c25-18(9-16-13-28-20(23-16)15-5-8-27-12-15)22-10-14-1-3-17(4-2-14)24-7-6-21-19(26)11-24/h1-5,8,12-13H,6-7,9-11H2,(H,21,26)(H,22,25) |
| InChIKey | WHVGZGBRGIYEIB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|